6-chloro-4-methoxypyridazin-3-amine - CAS 808770-39-0
Catalog: |
BB036576 |
Product Name: |
6-chloro-4-methoxypyridazin-3-amine |
CAS: |
808770-39-0 |
Synonyms: |
6-chloro-4-methoxy-3-pyridazinamine; 6-chloro-4-methoxypyridazin-3-amine |
IUPAC Name: | 6-chloro-4-methoxypyridazin-3-amine |
Description: | 6-chloro-4-methoxypyridazin-3-amine (CAS# 808770-39-0) is a useful research chemical. |
Molecular Weight: | 159.573 |
Molecular Formula: | C5H6ClN3O |
Canonical SMILES: | COC1=CC(=NN=C1N)Cl |
InChI: | InChI=1S/C5H6ClN3O/c1-10-3-2-4(6)8-9-5(3)7/h2H,1H3,(H2,7,9) |
InChI Key: | KCKFEBMJVVTSKC-UHFFFAOYSA-N |
LogP: | 0.65090 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021086785-A1 | Bifunctional compounds | 20191028 |
US-2020181153-A1 | Imidazopyridazinone compounds and uses thereof | 20181210 |
WO-2020123422-A1 | Imidazopyridazinone compounds and uses thereof | 20181210 |
US-2021269454-A1 | Cycloalkane-1,3-diamine derivative | 20181206 |
AU-2018355743-A1 | Pyridine carbonyl derivatives and therapeutic uses thereof as TRPC6 inhibitors | 20171027 |
Complexity: | 113 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 159.0199395 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 159.0199395 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 61 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridazines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS