6-Chloro-2-pyrazinecarbaldehyde - CAS 874114-34-8
Catalog: |
BB038427 |
Product Name: |
6-Chloro-2-pyrazinecarbaldehyde |
CAS: |
874114-34-8 |
Synonyms: |
6-chloro-2-pyrazinecarboxaldehyde; 6-chloropyrazine-2-carbaldehyde |
IUPAC Name: | 6-chloropyrazine-2-carbaldehyde |
Description: | 6-Chloro-2-pyrazinecarbaldehyde (CAS# 874114-34-8) is a useful research chemical. |
Molecular Weight: | 142.54 |
Molecular Formula: | C5H3ClN2O |
Canonical SMILES: | C1=C(N=C(C=N1)Cl)C=O |
InChI: | InChI=1S/C5H3ClN2O/c6-5-2-7-1-4(3-9)8-5/h1-3H |
InChI Key: | NWLIHAPBHUZMAD-UHFFFAOYSA-N |
Appearance: | Yellow to brown solid |
LogP: | 0.94250 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021127397-A1 | Nitrogen heterocyclic compounds and methods of use | 20191219 |
WO-2021117846-A1 | Compound serving as pdgf receptor kinase inhibitor, and composition | 20191213 |
WO-2015113927-A1 | Amino-substituted isothiazoles | 20140129 |
EP-3042900-A1 | Novel morpholine derivative or salt thereof | 20130829 |
JP-6074043-B2 | Novel morpholine derivative or salt thereof | 20130829 |
Complexity: | 109 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 141.9933904 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 141.9933904 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 42.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS