6-Chloro-2-methylquinoline-3-carboxylic acid ethyl ester - CAS 114858-39-8
Catalog: |
BB003443 |
Product Name: |
6-Chloro-2-methylquinoline-3-carboxylic acid ethyl ester |
CAS: |
114858-39-8 |
Synonyms: |
ethyl 6-chloro-2-methylquinoline-3-carboxylate |
IUPAC Name: | ethyl 6-chloro-2-methylquinoline-3-carboxylate |
Description: | 6-Chloro-2-methylquinoline-3-carboxylic acid ethyl ester (CAS# 114858-39-8) is a useful research chemical. |
Molecular Weight: | 249.69 |
Molecular Formula: | C13H12ClNO2 |
Canonical SMILES: | CCOC(=O)C1=C(N=C2C=CC(=CC2=C1)Cl)C |
InChI: | InChI=1S/C13H12ClNO2/c1-3-17-13(16)11-7-9-6-10(14)4-5-12(9)15-8(11)2/h4-7H,3H2,1-2H3 |
InChI Key: | KZZFZNSEHULNFN-UHFFFAOYSA-N |
Boiling Point: | 340.4 °C at 760 mmHg |
Purity: | 95 % |
Density: | 1.252 g/cm3 |
LogP: | 3.37330 |
Publication Number | Title | Priority Date |
ES-2606724-A1 | Synthesis of quinolines using catalysts based on carbon aerogels (Machine-translation by Google Translate, not legally binding) | 20150924 |
ES-2606724-B1 | Synthesis of quinolines using carbon aerogels based catalysts | 20150924 |
US-2004009976-A1 | Hypoglycemic imidazoline compounds | 20020430 |
US-6410562-B1 | Hypoglycemic imidazoline compounds | 19981218 |
DE-69814012-T2 | Hypoglycemic imidazoline derivatives | 19971219 |
Complexity: | 285 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 249.0556563 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 249.0556563 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 39.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinoline/Isoquinoline
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS