6-Chloro-2-hydroxypyridine - CAS 16879-02-0
Catalog: |
BB012492 |
Product Name: |
6-Chloro-2-hydroxypyridine |
CAS: |
16879-02-0 |
Synonyms: |
6-chloro-1H-pyridin-2-one |
IUPAC Name: | 6-chloro-1H-pyridin-2-one |
Description: | 6-Chloro-2-hydroxypyridine (CAS# 16879-02-0) is used in preparation of Pyrimidine compound for treatment and/or diagnosis of seizure. |
Molecular Weight: | 129.54 |
Molecular Formula: | C5H4ClNO |
Canonical SMILES: | C1=CC(=O)NC(=C1)Cl |
InChI: | InChI=1S/C5H4ClNO/c6-4-2-1-3-5(8)7-4/h1-3H,(H,7,8) |
InChI Key: | CLNNBQDAAGDAHI-UHFFFAOYSA-N |
Boiling Point: | 206 °C |
Density: | 1.35 g/cm3 |
MDL: | MFCD00006278 |
LogP: | 1.44060 |
GHS Hazard Statement: | H302 (11.11%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111233931-A | Synthesis method of Reidesciclovir | 20200326 |
KR-20210059584-A | Glp-1 receptor agonist and use thereof | 20191115 |
KR-20210059653-A | Glp-1 receptor agonist and use thereof | 20191115 |
WO-2021096304-A1 | Glp-1 receptor agonist and use thereof | 20191115 |
WO-2021081207-A1 | Glp-1r modulating compounds | 20191025 |
PMID | Publication Date | Title | Journal |
20520908 | 20100721 | Synthesis and structural and magnetic characterization of a hexadecanuclear cobalt phosphonate compound | Dalton transactions (Cambridge, England : 2003) |
21491697 | 20100528 | Supertetrahedral icosanuclear and ring-like decanuclear mixed valent manganese(II/III) triethanolamine clusters | Dalton transactions (Cambridge, England : 2003) |
19842045 | 20091001 | Let's not forget tautomers | Journal of computer-aided molecular design |
19606844 | 20090817 | Synthesis of tetranuclear rhodium and iridium complexes directed by 6-mercaptopyridin-2-ol: electrochemical behavior, chemical oxidation, and coordination chemistry | Inorganic chemistry |
19352539 | 20090428 | Synthesis and structural and magnetic characterisation of cobalt(II)-sodium phosphonate cage compounds | Dalton transactions (Cambridge, England : 2003) |
Complexity: | 171 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 128.9981414 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 128.9981414 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 29.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS