6-Bromonaphthalene-2-sulfonyl Chloride - CAS 50637-98-4
Catalog: |
BB027158 |
Product Name: |
6-Bromonaphthalene-2-sulfonyl Chloride |
CAS: |
50637-98-4 |
Synonyms: |
6-bromo-2-naphthalenesulfonyl chloride; 6-bromonaphthalene-2-sulfonyl chloride |
IUPAC Name: | 6-bromonaphthalene-2-sulfonyl chloride |
Description: | 6-Bromonaphthalene-2-sulfonyl Chloride (CAS# 50637-98-4) is a useful research chemical. |
Molecular Weight: | 305.58 |
Molecular Formula: | C10H6BrClO2S |
Canonical SMILES: | C1=CC2=C(C=CC(=C2)Br)C=C1S(=O)(=O)Cl |
InChI: | InChI=1S/C10H6BrClO2S/c11-9-3-1-8-6-10(15(12,13)14)4-2-7(8)5-9/h1-6H |
InChI Key: | RDKORFDRILIBOL-UHFFFAOYSA-N |
LogP: | 4.61060 |
Publication Number | Title | Priority Date |
CA-2507026-A1 | Imidazole derivatives, their production and use | 20021122 |
EP-1564213-A1 | Imidazole derivative, process for producing the same, and use | 20021122 |
JP-2004182730-A | Imidazole derivatives, their production and use | 20021122 |
US-2007004736-A1 | Imidazole derivative, process for producing the same, and use | 20021122 |
US-2011009389-A1 | Imidazole derivative, their production and use | 20021122 |
Complexity: | 325 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 303.89604 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 303.89604 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 42.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS