6-Bromo-N,N-dimethylnaphthalene-2-sulfonamide - CAS 590417-36-0
Catalog: |
BB030249 |
Product Name: |
6-Bromo-N,N-dimethylnaphthalene-2-sulfonamide |
CAS: |
590417-36-0 |
Synonyms: |
6-bromo-N,N-dimethyl-2-naphthalenesulfonamide; 6-bromo-N,N-dimethylnaphthalene-2-sulfonamide |
IUPAC Name: | 6-bromo-N,N-dimethylnaphthalene-2-sulfonamide |
Description: | 6-Bromo-N,N-dimethylnaphthalene-2-sulfonamide (CAS# 590417-36-0 ) is a useful research chemical. |
Molecular Weight: | 314.20 |
Molecular Formula: | C12H12BrNO2S |
Canonical SMILES: | CN(C)S(=O)(=O)C1=CC2=C(C=C1)C=C(C=C2)Br |
InChI: | InChI=1S/C12H12BrNO2S/c1-14(2)17(15,16)12-6-4-9-7-11(13)5-3-10(9)8-12/h3-8H,1-2H3 |
InChI Key: | WPSGOBFUOJOCPL-UHFFFAOYSA-N |
LogP: | 3.93340 |
Publication Number | Title | Priority Date |
AU-2003211384-A1 | Substituted phenylalkanoic acid derivative and use thereof | 20020221 |
AU-2003211384-B2 | Substituted phenylalkanoic acid derivative and use thereof | 20020221 |
CA-2477208-C | Substituted phenylalkanoic acid derivatives and use thereof | 20020221 |
EP-1477472-A1 | Substituted phenylalkanoic acid derivative and use thereof | 20020221 |
EP-1477472-B1 | Substituted phenylalkanoic acid derivative and use thereof | 20020221 |
Complexity: | 363 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 312.97721 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 312.97721 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 45.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS