6-Bromo-7-fluorobenzofuran - CAS 1427363-07-2
Catalog: |
BB009408 |
Product Name: |
6-Bromo-7-fluorobenzofuran |
CAS: |
1427363-07-2 |
Synonyms: |
6-bromo-7-fluorobenzofuran; 6-bromo-7-fluoro-1-benzofuran |
IUPAC Name: | 6-bromo-7-fluoro-1-benzofuran |
Description: | 6-Bromo-7-fluorobenzofuran (CAS# 1427363-07-2) is a useful research chemical compound. |
Molecular Weight: | 215.02 |
Molecular Formula: | C8H4BrFO |
Canonical SMILES: | C1=CC(=C(C2=C1C=CO2)F)Br |
InChI: | InChI=1S/C8H4BrFO/c9-6-2-1-5-3-4-11-8(5)7(6)10/h1-4H |
InChI Key: | DDNFNBKKCMLAML-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
AU-2014235452-A1 | 4-amino-6-(heterocyclic)picolinates and 6-amino-2-(heterocyclic) pyrimidine-4-carboxylates and their use as herbicides | 20130315 |
AU-2014235452-B2 | 4-amino-6-(heterocyclic)picolinates and 6-amino-2-(heterocyclic) pyrimidine-4-carboxylates and their use as herbicides | 20130315 |
AU-2018214049-A1 | 4-amino-6-(heterocyclic)picolinates and 6-amino-2-(heterocyclic) pyrimidine-4-carboxylates and their use as herbicides | 20130315 |
AU-2018214049-B2 | 4-amino-6-(heterocyclic)picolinates and 6-amino-2-(heterocyclic) pyrimidine-4-carboxylates and their use as herbicides | 20130315 |
AU-2020203413-A1 | 4-amino-6-(heterocyclic)picolinates and 6-amino-2-(heterocyclic) pyrimidine-4-carboxylates and their use as herbicides | 20130315 |
Complexity: | 153 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 213.94296 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 213.94296 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 13.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzofuran/Benzothiophene
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS