6-Bromo-4-fluoro-2,3-dihydroinden-1-one - CAS 881189-74-8
Catalog: |
BB038739 |
Product Name: |
6-Bromo-4-fluoro-2,3-dihydroinden-1-one |
CAS: |
881189-74-8 |
Synonyms: |
6-bromo-4-fluoro-2,3-dihydroinden-1-one; 6-bromo-4-fluoro-2,3-dihydroinden-1-one |
IUPAC Name: | 6-bromo-4-fluoro-2,3-dihydroinden-1-one |
Description: | 6-Bromo-4-fluoro-2,3-dihydroinden-1-one (CAS# 881189-74-8) is a useful research chemical. |
Molecular Weight: | 229.05 |
Molecular Formula: | C9H6BrFO |
Canonical SMILES: | C1CC(=O)C2=CC(=CC(=C21)F)Br |
InChI: | InChI=1S/C9H6BrFO/c10-5-3-7-6(8(11)4-5)1-2-9(7)12/h3-4H,1-2H2 |
InChI Key: | FVPXVDTWEBFLLE-UHFFFAOYSA-N |
MDL: | MFCD14654077 |
LogP: | 2.71710 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P317, P330, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021053617-A1 | Mll1 inhibitors and anti-cancer agents | 20190920 |
WO-2020210828-A1 | (aza)indazolyl-aryl sulfonamide and related compounds and their use in treating medical conditions | 20190412 |
WO-2020127685-A1 | Amino-acid anilides as small molecule modulators of il-17 | 20181219 |
TW-202039473-A | Small molecule modulators of il-17 | 20181219 |
CN-113164448-A | Amino acid anilines as small molecule modulators of IL-17 | 20181219 |
Complexity: | 207 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 227.95861 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 227.95861 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 17.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS