6-Bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine - CAS 1166819-53-9
Catalog: |
BB003797 |
Product Name: |
6-Bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
CAS: |
1166819-53-9 |
Synonyms: |
6-bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine; 6-bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
IUPAC Name: | 6-bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
Description: | 6-Bromo-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine (CAS# 1166819-53-9) is a useful research chemical. |
Molecular Weight: | 266.02 |
Molecular Formula: | C7H3BrF3N3 |
Canonical SMILES: | C1=CC2=NN=C(N2C=C1Br)C(F)(F)F |
InChI: | InChI=1S/C7H3BrF3N3/c8-4-1-2-5-12-13-6(7(9,10)11)14(5)3-4/h1-3H |
InChI Key: | SYYNJBWDDYHXEY-UHFFFAOYSA-N |
LogP: | 2.51060 |
Publication Number | Title | Priority Date |
US-2020377499-A1 | Ion channel modulators | 20190531 |
EP-3444246-A1 | 2,4-disubstituted pyrimidine derivative as cdk inhibitor and use thereof | 20160411 |
EP-3444246-B1 | 2,4-disubstituted pyrimidine derivative as cdk inhibitor and use thereof | 20160411 |
JP-6661048-B2 | 2,4-Disubstituted pyrimidine derivatives as CDK inhibitors, pharmaceutically acceptable salts thereof, and pharmaceutical compositions | 20160411 |
US-10464927-B2 | 2,4-disubstituted pyrimidines as CDK inhibitors | 20160411 |
Complexity: | 223 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 264.94624 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 264.94624 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 30.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS