6-Bromo-3-chloro-2-methylpyridine - CAS 944317-27-5
Catalog: |
BB041311 |
Product Name: |
6-Bromo-3-chloro-2-methylpyridine |
CAS: |
944317-27-5 |
Synonyms: |
6-bromo-3-chloro-2-methylpyridine; 6-bromo-3-chloro-2-methylpyridine |
IUPAC Name: | 6-bromo-3-chloro-2-methylpyridine |
Description: | 6-Bromo-3-chloro-2-methylpyridine (CAS# 944317-27-5) is a useful research chemical. |
Molecular Weight: | 206.47 |
Molecular Formula: | C6H5BrClN |
Canonical SMILES: | CC1=C(C=CC(=N1)Br)Cl |
InChI: | InChI=1S/C6H5BrClN/c1-4-5(8)2-3-6(7)9-4/h2-3H,1H3 |
InChI Key: | PSZRCSVBLJMQLL-UHFFFAOYSA-N |
Boiling Point: | 221.763 °C at 760 mmHg |
Density: | 1.625 g/cm3 |
MDL: | MFCD11110679 |
LogP: | 2.80590 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2020125627-A1 | Phenylpyrrolidine compound and use thereof | 20181218 |
CN-111333626-A | Phenyl pyrrolidine compounds and uses thereof | 20181218 |
EP-3901146-A1 | Phenylpyrrolidine compound and use thereof | 20181218 |
KR-20210093320-A | Phenylpyrrolidine-based compounds and uses thereof | 20181218 |
WO-2020104335-A1 | Alpha-d-galactoside inhibitors of galectins | 20181121 |
Complexity: | 99.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 204.92939 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 204.92939 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS