6-Bromo-2-methyl-2,3-dihydro-1-indanone - CAS 176088-59-8
Catalog: |
BB013194 |
Product Name: |
6-Bromo-2-methyl-2,3-dihydro-1-indanone |
CAS: |
176088-59-8 |
Synonyms: |
6-bromo-2-methyl-2,3-dihydroinden-1-one; 6-bromo-2-methyl-2,3-dihydroinden-1-one |
IUPAC Name: | 6-bromo-2-methyl-2,3-dihydroinden-1-one |
Description: | 6-Bromo-2-methyl-2,3-dihydro-1-indanone (CAS# 176088-59-8) is a useful research chemical. |
Molecular Weight: | 225.08 |
Molecular Formula: | C10H9BrO |
Canonical SMILES: | CC1CC2=C(C1=O)C=C(C=C2)Br |
InChI: | InChI=1S/C10H9BrO/c1-6-4-7-2-3-8(11)5-9(7)10(6)12/h2-3,5-6H,4H2,1H3 |
InChI Key: | GMJKJIUETGRADG-UHFFFAOYSA-N |
LogP: | 2.82400 |
Publication Number | Title | Priority Date |
TW-201938517-A | Benzoheterocyclic compounds and uses thereof | 20171201 |
US-2020157088-A1 | Benzene fused heterocyclic compound and use thereof | 20171201 |
WO-2019108943-A1 | Benzene fused heterocyclic compound and use thereof | 20171201 |
CN-111491928-A | Benzoheterocyclic compounds and uses thereof | 20171201 |
EP-3717467-A1 | Benzene fused heterocyclic compound and use thereof | 20171201 |
Complexity: | 202 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 223.98368 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 223.98368 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 17.1 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS