6-Bromo-2-chloro-8-methoxyquinazoline - CAS 953039-14-0
Catalog: |
BB041676 |
Product Name: |
6-Bromo-2-chloro-8-methoxyquinazoline |
CAS: |
953039-14-0 |
Synonyms: |
6-bromo-2-chloro-8-methoxyquinazoline; 6-bromo-2-chloro-8-methoxyquinazoline |
IUPAC Name: | 6-bromo-2-chloro-8-methoxyquinazoline |
Description: | 6-Bromo-2-chloro-8-methoxyquinazoline (CAS# 953039-14-0) is a useful research chemical. |
Molecular Weight: | 273.51 |
Molecular Formula: | C9H6BrClN2O |
Canonical SMILES: | COC1=C2C(=CC(=C1)Br)C=NC(=N2)Cl |
InChI: | InChI=1S/C9H6BrClN2O/c1-14-7-3-6(10)2-5-4-12-9(11)13-8(5)7/h2-4H,1H3 |
InChI Key: | AJDRLOKFLWCFAY-UHFFFAOYSA-N |
Boiling Point: | 342.1±35.0 °C at 760 mmHg |
Density: | 1.7±0.1 g/cm3 |
LogP: | 3.05430 |
Publication Number | Title | Priority Date |
CA-3033370-A1 | Certain chemical entities, compositions, and methods | 20160815 |
EP-3497087-A1 | Certain chemical entities, compositions, and methods | 20160815 |
JP-2019526550-A | Specific chemical entities, compositions and methods | 20160815 |
US-10544106-B2 | Certain chemical entities, compositions, and methods | 20160815 |
US-2018072688-A1 | Certain chemical entities, compositions, and methods | 20160815 |
Complexity: | 207 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 271.9352 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 271.9352 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 35 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinazolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS