6-Bromo-1-tetralone - CAS 66361-67-9
Catalog: |
BB033009 |
Product Name: |
6-Bromo-1-tetralone |
CAS: |
66361-67-9 |
Synonyms: |
6-bromo-3,4-dihydro-2H-naphthalen-1-one; 6-bromo-3,4-dihydro-2H-naphthalen-1-one |
IUPAC Name: | 6-bromo-3,4-dihydro-2H-naphthalen-1-one |
Description: | 6-Bromo-1-tetralone (CAS# 66361-67-9) is a useful research chemical. |
Molecular Weight: | 225.08 |
Molecular Formula: | C10H9BrO |
Canonical SMILES: | C1CC2=C(C=CC(=C2)Br)C(=O)C1 |
InChI: | InChI=1S/C10H9BrO/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6H,1-3H2 |
InChI Key: | OSDHOOBPMBLALZ-UHFFFAOYSA-N |
Boiling Point: | 323.109 ℃ at 760 mmHg |
Density: | 1.511 g/cm3 |
Appearance: | Pink chunks |
LogP: | 2.96810 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-3890041-A1 | New chemical compounds, optoelectronic elements comprising at least one new chemical compound, and use of new chemical compounds in an optoelectronic element | 20200331 |
WO-2021198388-A1 | New chemical compounds, optoelectronic elements comprising at least one new chemical compound, and use of new chemical compounds in an optoelectronic element | 20200331 |
KR-20210059633-A | Novel derivatives having 1,2,3,4-tetrahydronaphthalene moiety or pharmaceutically acceptable salt thereof and pharmaceutical compositions comprising the same | 20191115 |
WO-2021096239-A1 | Novel derivatives having 1,2,3,4-tetrahydronaphthalene moiety or pharmaceutically acceptable salt thereof and pharmaceutical compositions comprising the same | 20191115 |
WO-2021097139-A1 | Chiral synthesis of a tertiary alcohol | 20191115 |
Complexity: | 190 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 223.98368 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 223.98368 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 17.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS