6-Bromo-1-nitro-2-naphthylamine - CAS 131707-40-9
Catalog: |
BB007472 |
Product Name: |
6-Bromo-1-nitro-2-naphthylamine |
CAS: |
131707-40-9 |
Synonyms: |
6-bromo-1-nitro-2-naphthalenamine; 6-bromo-1-nitronaphthalen-2-amine |
IUPAC Name: | 6-bromo-1-nitronaphthalen-2-amine |
Description: | 6-Bromo-1-nitro-2-naphthylamine (CAS# 131707-40-9) is a useful research chemical. |
Molecular Weight: | 267.08 |
Molecular Formula: | C10H7BrN2O2 |
Canonical SMILES: | C1=CC2=C(C=CC(=C2[N+](=O)[O-])N)C=C1Br |
InChI: | InChI=1S/C10H7BrN2O2/c11-7-2-3-8-6(5-7)1-4-9(12)10(8)13(14)15/h1-5H,12H2 |
InChI Key: | MQNYSLDYJQCSDS-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
KR-20210078631-A | Organic compound and organic electroluminescent device using the same | 20191218 |
WO-2016141890-A1 | Compounds as hepatitis c virus inhibitors and pharmaceutical uses thereof | 20150312 |
US-2015057246-A1 | Silyl-containing heterocyclic compounds and methods of use thereof for the treatment of viral diseases | 20110914 |
AU-2011328980-A1 | Antiviral compounds | 20101117 |
AU-2015243078-A1 | Antiviral compounds | 20101117 |
Complexity: | 256 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 265.96909 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 265.96909 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 71.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS