6-Bromo-1,1-dimethylindane - CAS 67159-88-0
Catalog: |
BB033204 |
Product Name: |
6-Bromo-1,1-dimethylindane |
CAS: |
67159-88-0 |
Synonyms: |
5-bromo-3,3-dimethyl-1,2-dihydroindene; 5-bromo-3,3-dimethyl-1,2-dihydroindene |
IUPAC Name: | 5-bromo-3,3-dimethyl-1,2-dihydroindene |
Description: | 6-Bromo-1,1-dimethylindane (CAS# 67159-88-0 ) is a useful research chemical. |
Molecular Weight: | 225.12 |
Molecular Formula: | C11H13Br |
Canonical SMILES: | CC1(CCC2=C1C=C(C=C2)Br)C |
InChI: | InChI=1S/C11H13Br/c1-11(2)6-5-8-3-4-9(12)7-10(8)11/h3-4,7H,5-6H2,1-2H3 |
InChI Key: | XTSAEIQNMRIQAS-UHFFFAOYSA-N |
LogP: | 3.67290 |
Publication Number | Title | Priority Date |
KR-20210059632-A | Novel derivatives having 2,3-dihydro-1H-indene or 2,3-dihydrobenzofuran moiety or pharmaceutically acceptable salt thereof and pharmaceutical compositions comprising the same | 20191115 |
WO-2021096238-A1 | Novel derivatives having 2,3-dihydro-1h-indene or 2,3-dihydrobenzofuran moiety or pharmaceutically acceptable salt thereof and pharmaceutical compositions comprising the same | 20191115 |
EP-3447045-A1 | Kcnq 2-5 channel activator | 20160422 |
JP-WO2017183723-A1 | KCNQ2-5 channel activator | 20160422 |
US-10519105-B2 | KCNQ2-5 channel activator | 20160422 |
Complexity: | 174 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 224.02006 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 224.02006 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS