5-Nitrobenzothiophene 1,1-Dioxide - CAS 90049-81-3
Catalog: |
BB039745 |
Product Name: |
5-Nitrobenzothiophene 1,1-Dioxide |
CAS: |
90049-81-3 |
Synonyms: |
5-nitro-1-benzothiophene 1,1-dioxide; 5-nitro-1-benzothiophene 1,1-dioxide |
IUPAC Name: | 5-nitro-1-benzothiophene 1,1-dioxide |
Description: | 5-Nitrobenzothiophene 1,1-Dioxide (CAS# 90049-81-3 ) is a useful research chemical. |
Molecular Weight: | 211.19 |
Molecular Formula: | C8H5NO4S |
Canonical SMILES: | C1=CC2=C(C=CS2(=O)=O)C=C1[N+](=O)[O-] |
InChI: | InChI=1S/C8H5NO4S/c10-9(11)7-1-2-8-6(5-7)3-4-14(8,12)13/h1-5H |
InChI Key: | DBSOUBWMAOIBPM-UHFFFAOYSA-N |
LogP: | 2.95680 |
Publication Number | Title | Priority Date |
US-2008019922-A1 | Quinazoline derivatives, their preparation, their use, and medicaments comprising them | 20060622 |
US-7741333-B2 | Quinazoline derivatives, their preparation, their use, and medicaments comprising them | 20060622 |
WO-2007147577-A1 | Quinazoline derivatives, their preparation, their use as tyrosine kinase inhibitors and medicaments comprising them | 20060622 |
US-2008056987-A1 | Quinoline derivatives, their preparation, their use, and medicaments comprising them | 20060621 |
US-2008108627-A1 | Cyanoquinoline derivatives, their preparation, their use, and medicaments comprising them | 20060621 |
Complexity: | 375 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 210.99392881 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 210.99392881 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 88.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS