5-Nitrobenzo[b]thiophen-3(2H)-one 1,1-Dioxide - CAS 343348-19-6
Catalog: |
BB022079 |
Product Name: |
5-Nitrobenzo[b]thiophen-3(2H)-one 1,1-Dioxide |
CAS: |
343348-19-6 |
Synonyms: |
5-nitro-1,1-dioxo-1-benzothiophen-3-one; 5-nitro-1,1-dioxo-1-benzothiophen-3-one |
IUPAC Name: | 5-nitro-1,1-dioxo-1-benzothiophen-3-one |
Description: | 5-Nitrobenzo[b]thiophen-3(2H)-one 1,1-Dioxide (CAS# 343348-19-6 ) is a useful research chemical. |
Molecular Weight: | 227.19 |
Molecular Formula: | C8H5NO5S |
Canonical SMILES: | C1C(=O)C2=C(S1(=O)=O)C=CC(=C2)[N+](=O)[O-] |
InChI: | InChI=1S/C8H5NO5S/c10-7-4-15(13,14)8-2-1-5(9(11)12)3-6(7)8/h1-3H,4H2 |
InChI Key: | FRVJPCXMCXAHGL-UHFFFAOYSA-N |
LogP: | 2.16880 |
Publication Number | Title | Priority Date |
WO-2021138694-A1 | Heteroaryl compounds as inhibitors of programmed necrosis pathway, composition and method using the same | 20200102 |
EP-0278910-A2 | Heavy metal complex dyestuffs, their preparation and their use | 19870211 |
EP-0278910-B1 | Heavy metal complex dyestuffs, their preparation and their use | 19870211 |
US-4960870-A | Heavy metal complex azo dyes containing a benzothiophene-1,1-dioxide, 2,1-benzothiazine-2,2-dioxide, 1,4-benzothiazine-1,1-dioxide or thienopyridine-1,1-dioxide coupling component | 19870211 |
Complexity: | 404 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 226.98884343 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 226.98884343 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 105 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS