5-Methylimidazo[1,2-a]pyridine-3-carbaldehyde - CAS 178488-37-4
Catalog: |
BB013473 |
Product Name: |
5-Methylimidazo[1,2-a]pyridine-3-carbaldehyde |
CAS: |
178488-37-4 |
Synonyms: |
5-methyl-3-imidazo[1,2-a]pyridinecarboxaldehyde; 5-methylimidazo[1,2-a]pyridine-3-carbaldehyde |
IUPAC Name: | 5-methylimidazo[1,2-a]pyridine-3-carbaldehyde |
Description: | 5-Methylimidazo[1,2-a]pyridine-3-carbaldehyde (CAS# 178488-37-4) is a useful research chemical. |
Molecular Weight: | 160.17 |
Molecular Formula: | C9H8N2O |
Canonical SMILES: | CC1=CC=CC2=NC=C(N12)C=O |
InChI: | InChI=1S/C9H8N2O/c1-7-3-2-4-9-10-5-8(6-12)11(7)9/h2-6H,1H3 |
InChI Key: | DUMDWTOBALQSBO-UHFFFAOYSA-N |
LogP: | 1.45520 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-113164458-A | Monoacylglycerol lipase modulators | 20180928 |
AU-2014230122-A1 | Pyrrolidine derivatives, pharmaceutical compositions containing them, and their use in therapy | 20130315 |
CA-2900888-A1 | Pyrrolidine derivatives, pharmaceutical compositions containing them, and their use in therapy | 20130315 |
EP-2970215-A1 | Pyrrolidine derivatives, pharmaceutical compositions containing them, and their use in therapy | 20130315 |
EP-2970215-B1 | Pyrrolidine derivatives, pharmaceutical compositions containing them, and their use in therapy | 20130315 |
Complexity: | 183 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 160.063662883 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 160.063662883 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 34.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS