5-Methylbenzoxazole-2-methanamine - CAS 944897-59-0
Catalog: |
BB041353 |
Product Name: |
5-Methylbenzoxazole-2-methanamine |
CAS: |
944897-59-0 |
Synonyms: |
(5-methyl-1,3-benzoxazol-2-yl)methanamine; (5-methyl-1,3-benzoxazol-2-yl)methanamine |
IUPAC Name: | (5-methyl-1,3-benzoxazol-2-yl)methanamine |
Description: | 5-Methylbenzoxazole-2-methanamine (CAS# 944897-59-0) is a useful research chemical compound. |
Molecular Weight: | 162.19 |
Molecular Formula: | C9H10N2O |
Canonical SMILES: | CC1=CC2=C(C=C1)OC(=N2)CN |
InChI: | InChI=1S/C9H10N2O/c1-6-2-3-8-7(4-6)11-9(5-10)12-8/h2-4H,5,10H2,1H3 |
InChI Key: | CAMYACYQXPBFRW-UHFFFAOYSA-N |
LogP: | 3.09720 |
Publication Number | Title | Priority Date |
US-2009048277-A1 | Pyridopyrimidone derivatives, preparation thereof, therapeutic use thereof | 20060113 |
US-7842806-B2 | Pyridopyrimidone derivatives, preparation thereof, therapeutic use thereof | 20060113 |
WO-2007080324-A2 | Pyridopyrimidone derivatives, preparation thereof, therapeutic use thereof | 20060113 |
EP-2020410-A1 | Pyrido[2,3d]pyrimidine derivatives, process for their preparation and their therapeutical use | 20050701 |
US-2008176874-A1 | Derivatives of Pyrido[2,3-d]pyrimidine, the Preparation Thereof, and the Therapeutic Application of the Same | 20050701 |
Complexity: | 163 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 162.079312947 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 162.079312947 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 52 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzoxazole/Benzothiazole
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS