5-Methyl-3-isoxazolemethanol - CAS 35166-33-7
Catalog: |
BB022513 |
Product Name: |
5-Methyl-3-isoxazolemethanol |
CAS: |
35166-33-7 |
Synonyms: |
(5-methyl-3-isoxazolyl)methanol; (5-methyl-1,2-oxazol-3-yl)methanol |
IUPAC Name: | (5-methyl-1,2-oxazol-3-yl)methanol |
Description: | 5-Methyl-3-isoxazolemethanol (CAS# 35166-33-7) is a useful research chemical. |
Molecular Weight: | 113.11 |
Molecular Formula: | C5H7NO2 |
Canonical SMILES: | CC1=CC(=NO1)CO |
InChI: | InChI=1S/C5H7NO2/c1-4-2-5(3-7)6-8-4/h2,7H,3H2,1H3 |
InChI Key: | MDYHWQQHEWDJKR-UHFFFAOYSA-N |
Boiling Point: | 64 °C (0.2 mmHg) |
Density: | 1.183 g/cm3 |
MDL: | MFCD00085129 |
LogP: | 0.47530 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112321590-A | Imidazo [2,1-F ] [1,2,4] triazin-4-amine derivatives as TLR8 agonists | 20190802 |
WO-2021023105-A1 | Imidazo[2,1-f][1,2,4]triazin-4-amine derivative used as tlr8 agonist | 20190802 |
WO-2020160711-A1 | Imidazo [2, 1-f] [1, 2, 4] triazin-4-amine derivatives as tlr7 agonist | 20190207 |
TW-202045508-A | Imidazo[2,1-f][1,2,4]triazin-4-amine derivatives as tlr7 agonist | 20190207 |
US-2021171475-A1 | Compounds | 20180831 |
Complexity: | 76.8 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 113.047678466 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 113.047678466 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 46.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS