5-Methyl-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxylic Acid - CAS 143809-21-6
Catalog: |
BB009669 |
Product Name: |
5-Methyl-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxylic Acid |
CAS: |
143809-21-6 |
Synonyms: |
5-methyl-2,3-dihydro-1,4-benzodioxin-6-carboxylic acid; 5-methyl-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid |
IUPAC Name: | 5-methyl-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid |
Description: | 5-Methyl-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxylic Acid (CAS# 143809-21-6) is a useful research chemical. |
Molecular Weight: | 194.18 |
Molecular Formula: | C10H10O4 |
Canonical SMILES: | CC1=C(C=CC2=C1OCCO2)C(=O)O |
InChI: | InChI=1S/C10H10O4/c1-6-7(10(11)12)2-3-8-9(6)14-5-4-13-8/h2-3H,4-5H2,1H3,(H,11,12) |
InChI Key: | YBPIZYYGBWSBKO-UHFFFAOYSA-N |
LogP: | 1.46440 |
Publication Number | Title | Priority Date |
CN-112714769-A | ROR-1 specific chimeric antigen receptor and uses thereof | 20180710 |
EP-3820484-A1 | Ror-1 specific chimeric antigen receptors and uses thereof | 20180710 |
WO-2019243526-A1 | Oga inhibitor compounds | 20180620 |
EP-3810593-A1 | Oga inhibitor compounds | 20180620 |
US-2021300943-A1 | Oga inhibitor compounds | 20180620 |
PMID | Publication Date | Title | Journal |
17237798 | 20070301 | Small-molecule regulation of zebrafish gene expression | Nature chemical biology |
Complexity: | 228 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 194.0579088 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 194.0579088 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 55.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS