5-Methoxy-6-(trifluoromethyl)indole - CAS 178896-78-1
Catalog: |
BB013513 |
Product Name: |
5-Methoxy-6-(trifluoromethyl)indole |
CAS: |
178896-78-1 |
Synonyms: |
5-methoxy-6-(trifluoromethyl)-1H-indole |
IUPAC Name: | 5-methoxy-6-(trifluoromethyl)-1H-indole |
Description: | 5-Methoxy-6-(trifluoromethyl)indole (CAS# 178896-78-1) is a useful research chemical compound. |
Molecular Weight: | 215.17 |
Molecular Formula: | C10H8F3NO |
Canonical SMILES: | COC1=C(C=C2C(=C1)C=CN2)C(F)(F)F |
InChI: | InChI=1S/C10H8F3NO/c1-15-9-4-6-2-3-14-8(6)5-7(9)10(11,12)13/h2-5,14H,1H3 |
InChI Key: | KNMAZUXTEPXPOM-UHFFFAOYSA-N |
LogP: | 3.19530 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]; H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] |
Precautionary Statement: | P264, P264+P265, P270, P280, P301+P316, P305+P351+P338, P321, P330, P337+P317, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CA-3060583-A1 | Substituted indoline derivatives as dengue viral replication inhibitors | 20170522 |
CN-110691773-A | Substituted indoline derivatives as inhibitors of dengue virus replication | 20170522 |
EP-3630723-A1 | Substituted indoline derivatives as dengue viral replication inhibitors | 20170522 |
KR-20200009027-A | Substituted Indoline Derivatives as Dengue Virus Replication Inhibitors | 20170522 |
TW-201908291-A | Substituted porphyrin derivative as a dengue virus replication inhibitor (2) | 20170522 |
Complexity: | 231 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 215.05579836 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 215.05579836 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 25 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS