(5-Iodo-pyridin-2-yl)-carbamic acid tert-butyl ester - CAS 375853-79-5
Catalog: |
BB023346 |
Product Name: |
(5-Iodo-pyridin-2-yl)-carbamic acid tert-butyl ester |
CAS: |
375853-79-5 |
Synonyms: |
tert-butyl N-(5-iodopyridin-2-yl)carbamate |
IUPAC Name: | tert-butyl N-(5-iodopyridin-2-yl)carbamate |
Description: | (5-Iodo-pyridin-2-yl)-carbamic acid tert-butyl ester (CAS# 375853-79-5) is a useful research chemical. |
Molecular Weight: | 320.13 |
Molecular Formula: | C10H13IN2O2 |
Canonical SMILES: | CC(C)(C)OC(=O)NC1=NC=C(C=C1)I |
InChI: | InChI=1S/C10H13IN2O2/c1-10(2,3)15-9(14)13-8-5-4-7(11)6-12-8/h4-6H,1-3H3,(H,12,13,14) |
InChI Key: | YZLXIVKPYUFJPN-UHFFFAOYSA-N |
Boiling Point: | 316.1 ℃ at 760 mmHg |
Density: | 1.652 g/cm3 |
Appearance: | Powder |
MDL: | MFCD03791267 |
LogP: | 3.10620 |
GHS Hazard Statement: | H302 (90.48%): Harmful if swallowed [Warning Acute toxicity, oral]; H317 (90.48%): May cause an allergic skin reaction [Warning Sensitization, Skin] |
Precautionary Statement: | P261, P264, P270, P272, P280, P301+P317, P302+P352, P321, P330, P333+P313, P362+P364, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
AU-2015101580-A4 | Novel compound for imaging tau protein accumulated in the brain | 20121221 |
CA-2894994-A1 | Compounds for imaging tau proteins that accumulate in brain | 20121221 |
CA-2894994-C | Compounds for imaging tau proteins that accumulate in brain | 20121221 |
EP-2767532-A1 | Novel compound for imaging tau protein accumulated in the brain | 20121221 |
EP-2767532-B1 | Novel compound for imaging tau protein accumulated in the brain | 20121221 |
Complexity: | 228 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 320.00218 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 320.00218 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 51.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
-
[1866059-82-6]
1,1,2,2-Tetrafluoro-3-methylsulfonylpropane
-
[72607-53-5]
N-(3-Aminopropyl)methacrylamide Hydrochloride
-
[104517-96-6]
Ioversol related compound B
-
[63528-29-0]
Ethyl(2-methylpropyl)amine hydrochloride
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[883-44-3]
N-(3-Hydroxypropyl)phthalimide
INDUSTRY LEADERS TRUST OUR PRODUCTS