5-Iodo-2-methylpyridine - CAS 695-17-0
Catalog: |
BB033853 |
Product Name: |
5-Iodo-2-methylpyridine |
CAS: |
695-17-0 |
Synonyms: |
5-iodo-2-methylpyridine; 5-iodo-2-methylpyridine |
IUPAC Name: | 5-iodo-2-methylpyridine |
Description: | 5-Iodo-2-methylpyridine (CAS# 695-17-0) is a useful research chemical. |
Molecular Weight: | 219.02 |
Molecular Formula: | C6H6IN |
Canonical SMILES: | CC1=NC=C(C=C1)I |
InChI: | InChI=1S/C6H6IN/c1-5-2-3-6(7)4-8-5/h2-4H,1H3 |
InChI Key: | FMOQWAKITQNDFW-UHFFFAOYSA-N |
Boiling Point: | 218.6 °C at 760 mmHg |
Density: | 1.81 g/cm3 |
MDL: | MFCD07437990 |
LogP: | 1.99460 |
Publication Number | Title | Priority Date |
WO-2021113698-A1 | Masp-2 inhibitors and methods of use | 20191204 |
US-2021167296-A1 | Organic compound containing heterocyclic ring and having low lumo properties, and organic electroluminescent device using the same | 20191203 |
WO-2021070957-A1 | Benzene condensed ring compound and medical composition containing same | 20191009 |
US-2021098700-A1 | Condensed-cyclic compound and organic light emitting device including the same | 20190927 |
US-2021098720-A1 | Heterocyclic compound and organic light-emitting device including the same | 20190926 |
Complexity: | 74.9 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 218.9545 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 218.9545 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS