5-(Hydroxymethyl)-2,2-dimethyl-1,3-dioxane - CAS 4728-12-5
Catalog: |
BB026250 |
Product Name: |
5-(Hydroxymethyl)-2,2-dimethyl-1,3-dioxane |
CAS: |
4728-12-5 |
Synonyms: |
(2,2-dimethyl-1,3-dioxan-5-yl)methanol; (2,2-dimethyl-1,3-dioxan-5-yl)methanol |
IUPAC Name: | (2,2-dimethyl-1,3-dioxan-5-yl)methanol |
Description: | 5-(Hydroxymethyl)-2,2-dimethyl-1,3-dioxane (CAS# 4728-12-5) is a useful research chemical compound. |
Molecular Weight: | 146.18 |
Molecular Formula: | C7H14O3 |
Canonical SMILES: | CC1(OCC(CO1)CO)C |
InChI: | InChI=1S/C7H14O3/c1-7(2)9-4-6(3-8)5-10-7/h6,8H,3-5H2,1-2H3 |
InChI Key: | BTAUZIVCHJIXAX-UHFFFAOYSA-N |
Boiling Point: | 207.7 °C at 760 mmHg |
Density: | 1.004 g/cm3 |
LogP: | 0.37780 |
Publication Number | Title | Priority Date |
WO-2021206182-A1 | Compound, contrast medium, and method for producing compound | 20200410 |
WO-2021191379-A1 | 5-amino-8-(4-pyridyl)-[1,2,4]triazolo[4,3-c]pyrimidin-3-one compounds for use against cancer | 20200326 |
US-2021147360-A1 | Ssao inhibitors and use thereof | 20191029 |
WO-2021041671-A1 | Kras g12d inhibitors | 20190829 |
WO-2021013481-A1 | Aqueous cationic polyurethane dispersions | 20190725 |
Complexity: | 101 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 146.094294304 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 146.094294304 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 38.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS