5-Hydroxybenzofuran-2-carboxylic Acid - CAS 56172-36-2
Catalog: |
BB029278 |
Product Name: |
5-Hydroxybenzofuran-2-carboxylic Acid |
CAS: |
56172-36-2 |
Synonyms: |
5-hydroxy-2-benzofurancarboxylic acid; 5-hydroxy-1-benzofuran-2-carboxylic acid |
IUPAC Name: | 5-hydroxy-1-benzofuran-2-carboxylic acid |
Description: | 5-Hydroxybenzofuran-2-carboxylic Acid (CAS# 56172-36-2) is a useful research chemical. |
Molecular Weight: | 178.14 |
Molecular Formula: | C9H6O4 |
Canonical SMILES: | C1=CC2=C(C=C1O)C=C(O2)C(=O)O |
InChI: | InChI=1S/C9H6O4/c10-6-1-2-7-5(3-6)4-8(13-7)9(11)12/h1-4,10H,(H,11,12) |
InChI Key: | SDFAGAYNULBGAX-UHFFFAOYSA-N |
LogP: | 1.83660 |
Publication Number | Title | Priority Date |
WO-2020009176-A1 | Amide compound having bet proteolysis-inducing action and medicinal application thereof | 20180704 |
WO-2011159781-A2 | Bitter taste modulators | 20100617 |
WO-2011127070-A2 | IRE-1α INHIBITORS | 20100405 |
US-2011003851-A1 | Small molecule hematopoietic growth factor mimetic compounds that activate hematopoietic growth factor receptors | 20090528 |
US-8680150-B2 | Small molecule hematopoietic growth factor mimetic compounds that activate hematopoietic growth factor receptors | 20090528 |
Complexity: | 216 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 178.02660867 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 178.02660867 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 70.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzofuran/Benzothiophene
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS