5-Fluorobenzoxazole - CAS 221347-71-3
Catalog: |
BB017415 |
Product Name: |
5-Fluorobenzoxazole |
CAS: |
221347-71-3 |
Synonyms: |
5-fluoro-1,3-benzoxazole; 5-fluoro-1,3-benzoxazole |
IUPAC Name: | 5-fluoro-1,3-benzoxazole |
Description: | 5-Fluorobenzoxazole (CAS# 221347-71-3) is a useful research chemical. |
Molecular Weight: | 137.11 |
Molecular Formula: | C7H4FNO |
Canonical SMILES: | C1=CC2=C(C=C1F)N=CO2 |
InChI: | InChI=1S/C7H4FNO/c8-5-1-2-7-6(3-5)9-4-10-7/h1-4H |
InChI Key: | ZRMPAEOUOPNNPZ-UHFFFAOYSA-N |
Boiling Point: | 188.186 °C at 760 mmHg |
Density: | 1.321 g/cm3 |
MDL: | MFCD08458151 |
LogP: | 1.96690 |
Publication Number | Title | Priority Date |
KR-102064611-B1 | Benzoxazole derivatives, method for preparing the same and pharmaceutical composition comprising the same | 20171013 |
KR-20190041897-A | Benzoxazole derivatives, method for preparing the same and pharmaceutical composition comprising the same | 20171013 |
KR-20190007391-A | Novel 1h-pyrazolopyridin derivatives and pharmaceutical composition comprising the same | 20170712 |
JP-2018036516-A | Laminate, transmitted light adjusting material, protective sheet material, spectacle lens and spectacles | 20160831 |
JP-6667405-B2 | Laminate, transmitted light adjusting material, protective sheet material, spectacle lens and spectacles | 20160831 |
Complexity: | 131 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 137.027691913 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 137.027691913 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzoxazole/Benzothiazole
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS