5-Fluorobenzo[b]thiophene - CAS 70060-12-7
Catalog: |
BB034063 |
Product Name: |
5-Fluorobenzo[b]thiophene |
CAS: |
70060-12-7 |
Synonyms: |
5-fluoro-1-benzothiophene; 5-fluoro-1-benzothiophene |
IUPAC Name: | 5-fluoro-1-benzothiophene |
Description: | 5-Fluorobenzo[b]thiophene (CAS# 70060-12-7) is a useful research chemical. |
Molecular Weight: | 152.19 |
Molecular Formula: | C8H5FS |
Canonical SMILES: | C1=CC2=C(C=CS2)C=C1F |
InChI: | InChI=1S/C8H5FS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H |
InChI Key: | VKBPSLNJNKFVAC-UHFFFAOYSA-N |
LogP: | 3.04040 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021023813-A1 | 5-heteroaryl-pyridin-2-amine confounds as neuropeptide ff receptor antagonists | 20190806 |
US-2020247926-A1 | Polymerizable monomer, polymer compound for conductive polymer, and method for producing the polymer compound | 20190131 |
CN-107226803-A | A kind of synthetic method of benzothiophenes | 20170720 |
US-2020165519-A1 | Polymerizable liquid crystal composition and retardation plate | 20170609 |
US-10559397-B2 | Conductive polymer composite and substrate | 20170222 |
Complexity: | 126 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 152.00959950 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 152.00959950 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 28.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzofuran/Benzothiophene
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS