5-Fluoro-4-chromanone - CAS 188826-32-6
Catalog: |
BB014558 |
Product Name: |
5-Fluoro-4-chromanone |
CAS: |
188826-32-6 |
Synonyms: |
5-fluoro-3,4-dihydro-2H-1-benzopyran-4-one; 5-fluoro-2,3-dihydrochromen-4-one |
IUPAC Name: | 5-fluoro-2,3-dihydrochromen-4-one |
Description: | 5-Fluoro-4-chromanone (CAS# 188826-32-6) is a useful research chemical. |
Molecular Weight: | 166.15 |
Molecular Formula: | C9H7FO2 |
Canonical SMILES: | C1COC2=C(C1=O)C(=CC=C2)F |
InChI: | InChI=1S/C9H7FO2/c10-6-2-1-3-8-9(6)7(11)4-5-12-8/h1-3H,4-5H2 |
InChI Key: | AVJVYZBPSAQLLA-UHFFFAOYSA-N |
Boiling Point: | 279.991 °C at 760 mmHg |
Density: | 1.298 g/cm3 |
LogP: | 1.79090 |
Publication Number | Title | Priority Date |
WO-2017222083-A1 | Novel compounds | 20160623 |
AU-2015362790-A1 | Geminal substituted quinuclidine amide compounds as agonists of alpha-7 nicotinic acetylcholine receptors | 20141216 |
CA-2971413-A1 | Geminal substituted quinuclidine amide compounds as agonists of alpha-7 nicotinic acetylcholine receptors | 20141216 |
EP-3233087-A1 | Geminal substituted quinuclidine amide compounds as agonists of alpha-7 nicotinic acetylcholine receptors | 20141216 |
EP-3233087-B1 | Geminal substituted quinuclidine amide compounds as agonists of alpha-7 nicotinic acetylcholine receptors | 20141216 |
Complexity: | 193 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 166.04300762 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 166.04300762 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 26.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzopyrans
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS