5-Fluoro-2H-benzo[b][1,4]oxazin-3(4H)-one - CAS 1221502-66-4
Catalog: |
BB005348 |
Product Name: |
5-Fluoro-2H-benzo[b][1,4]oxazin-3(4H)-one |
CAS: |
1221502-66-4 |
Synonyms: |
5-fluoro-4H-1,4-benzoxazin-3-one; 5-fluoro-4H-1,4-benzoxazin-3-one |
IUPAC Name: | 5-fluoro-4H-1,4-benzoxazin-3-one |
Description: | 5-Fluoro-2H-benzo[b][1,4]oxazin-3(4H)-one (CAS# 1221502-66-4) is a useful research chemical. |
Molecular Weight: | 167.14 |
Molecular Formula: | C8H6FNO2 |
Canonical SMILES: | C1C(=O)NC2=C(O1)C=CC=C2F |
InChI: | InChI=1S/C8H6FNO2/c9-5-2-1-3-6-8(5)10-7(11)4-12-6/h1-3H,4H2,(H,10,11) |
InChI Key: | PPGFMQYLGBSWLA-UHFFFAOYSA-N |
Storage: | Sealed in dry, 2-8 ℃ |
LogP: | 1.24170 |
Publication Number | Title | Priority Date |
EP-2429993-B1 | Inhibitors of human immunodeficiency virus replication | 20090515 |
US-2010292227-A1 | Inhibitors of human immunodeficiency virus replication | 20090515 |
US-2013203747-A1 | Inhibitors of human immunodeficiency virus replication | 20090515 |
US-8338441-B2 | Inhibitors of human immunodeficiency virus replication | 20090515 |
US-8841331-B2 | Inhibitors of human immunodeficiency virus replication | 20090515 |
Complexity: | 198 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 167.0382566 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 167.0382566 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 38.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS