(5-Fluoro-1H-benzimidazol-2-yl)methanol - CAS 39811-07-9
Catalog: |
BB024141 |
Product Name: |
(5-Fluoro-1H-benzimidazol-2-yl)methanol |
CAS: |
39811-07-9 |
Synonyms: |
(6-fluoro-1H-benzimidazol-2-yl)methanol |
IUPAC Name: | (6-fluoro-1H-benzimidazol-2-yl)methanol |
Description: | (5-Fluoro-1H-benzimidazol-2-yl)methanol (CAS# 39811-07-9) is a useful research chemical. |
Molecular Weight: | 166.15 |
Molecular Formula: | C8H7FN2O |
Canonical SMILES: | C1=CC2=C(C=C1F)NC(=N2)CO |
InChI: | InChI=1S/C8H7FN2O/c9-5-1-2-6-7(3-5)11-8(4-12)10-6/h1-3,12H,4H2,(H,10,11) |
InChI Key: | WFGVOSSDGZOYNE-UHFFFAOYSA-N |
Boiling Point: | 416.1 °C at 760 mmHg |
Purity: | 95 % |
Density: | 1.468 g/cm3 |
MDL: | MFCD09261475 |
LogP: | 1.19430 |
Publication Number | Title | Priority Date |
US-2015168415-A1 | Compounds and methods for analysis and synthesis of saccharide compounds | 20131212 |
US-2015004533-A1 | Actinic ray-sensitive or radiation-sensitive resin composition, and, actinic ray-sensitive or radiation-sensitive film and pattern forming method, each using the same | 20120329 |
US-9323153-B2 | Actinic ray-sensitive or radiation-sensitive resin composition, and, actinic ray-sensitive or radiation-sensitive film and pattern forming method, each using the same | 20120329 |
WO-2013147286-A1 | Actinic ray-sensitive or radiation-sensitive resin composition, and, actinic ray-sensitive or radiation-sensitive film and pattern forming method, each using the same | 20120329 |
US-2015191439-A1 | Inhibitors targeting drug-resistant influenza a | 20111206 |
Complexity: | 167 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 166.05424101 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 166.05424101 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 48.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Fluorinated Building Blocks
-
[1946823-77-3]
[1,4-Dimethyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]methanol
-
[1106917-71-8]
[3-(Difluoromethoxy)phenyl]methanamine hydrochloride
-
[2367-82-0]
1,2,3,5-Tetrafluorobenzene
-
[2454490-85-6]
2-(7,8-Difluoro-1-naphthyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
-
[1018125-51-3]
2-(6-Ethyl-3-methyl-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridin-1-yl)acetic acid
-
[1975118-13-8]
4-[3-(Difluoromethyl)-4-methyl-1H-pyrazol-1-yl]aniline
Other Pyrimidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS