5-(Dimethylamino)pentanenitrile - CAS 3209-45-8
Catalog: |
BB021165 |
Product Name: |
5-(Dimethylamino)pentanenitrile |
CAS: |
3209-45-8 |
Synonyms: |
5-(dimethylamino)pentanenitrile; 5-(dimethylamino)pentanenitrile |
IUPAC Name: | 5-(dimethylamino)pentanenitrile |
Description: | 5-(Dimethylamino)pentanenitrile (CAS# 3209-45-8 ) is a useful research chemical. |
Molecular Weight: | 126.20 |
Molecular Formula: | C7H14N2 |
Canonical SMILES: | CN(C)CCCCC#N |
InChI: | InChI=1S/C7H14N2/c1-9(2)7-5-3-4-6-8/h3-5,7H2,1-2H3 |
InChI Key: | XUNJHMIOVRBSAV-UHFFFAOYSA-N |
LogP: | 1.24188 |
Publication Number | Title | Priority Date |
CN-103025816-A | Polymers functionalized with nitrile compounds containing a protected amino group | 20100122 |
CN-103025816-B | Polymers functionalized with nitrile compounds containing a protected amino group | 20100122 |
EP-2526149-A2 | Polymers functionalized with nitrile compounds containing a protected amino group | 20100122 |
EP-2526149-B1 | Polymers functionalized with nitrile compounds containing a protected amino group | 20100122 |
JP-2013518928-A | Polymers functionalized with nitrile compounds containing protected amino groups | 20100122 |
Complexity: | 98.7 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 126.115698455 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 126.115698455 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 27 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS