5-Chloro-2,4-difluorobenzyl Amine - CAS 924818-16-6
Catalog: |
BB040531 |
Product Name: |
5-Chloro-2,4-difluorobenzyl Amine |
CAS: |
924818-16-6 |
Synonyms: |
(5-chloro-2,4-difluorophenyl)methanamine; (5-chloro-2,4-difluorophenyl)methanamine |
IUPAC Name: | (5-chloro-2,4-difluorophenyl)methanamine |
Description: | 5-Chloro-2,4-difluorobenzyl Amine (CAS# 924818-16-6) is a useful research chemical compound. |
Molecular Weight: | 177.58 |
Molecular Formula: | C7H6ClF2N |
Canonical SMILES: | C1=C(C(=CC(=C1Cl)F)F)CN |
InChI: | InChI=1S/C7H6ClF2N/c8-5-1-4(3-11)6(9)2-7(5)10/h1-2H,3,11H2 |
InChI Key: | CZMMBJBQUHJIGX-UHFFFAOYSA-N |
Boiling Point: | 217 °C at 760 mmHg |
Density: | 1.368 g/cm3 |
LogP: | 2.77720 |
Publication Number | Title | Priority Date |
AU-2015369817-A1 | Polycyclic-carbamoylpyridone compounds and their pharmaceutical use | 20141223 |
AU-2015369817-B2 | Polycyclic-carbamoylpyridone compounds and their pharmaceutical use | 20141223 |
AU-2019200422-A1 | Polycyclic-carbamoylpyridone compounds and their pharmaceutical use | 20141223 |
BR-102015032109-A2 | polycyclic carbamoylpyridone compounds and their pharmaceutical use | 20141223 |
CA-2969244-A1 | Polycyclic-carbamoylpyridone compounds and their pharmaceutical use | 20141223 |
Complexity: | 134 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 177.0156832 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 177.0156832 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 26 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
-
[77943-39-6]
(4R,5S)-(+)-4-Methyl-5-phenyl-2-oxazolidinone
-
[6313-33-3]
Formamidine hydrochloride
-
[1388152-02-0]
1,2-Cyclopentanediol, 3-amino-5-[(phosphonooxy)methy]-, ammonium salt (1:2), (1R,2S,3R,5R)-
-
[1314965-08-6]
2-Oxa-8-azaspiro[4.5]decan-1-one hydrochloride
-
[1032314-85-4]
Benzamide, N-[4-methyl-3-[[4-(6-methyl-3-pyridinyl)-2-pyrimidinyl]amino]phenyl]-4-[(4-methyl-1-piperazinyl)methyl]-
-
[94-60-0]
Dimethyl cyclohexane-1,4-dicarboxylate, mixture of cis and trans
INDUSTRY LEADERS TRUST OUR PRODUCTS