5-Chloro-1-methylimidazole - CAS 872-49-1
Catalog: |
BB038356 |
Product Name: |
5-Chloro-1-methylimidazole |
CAS: |
872-49-1 |
Synonyms: |
5-chloro-1-methylimidazole; 5-chloro-1-methylimidazole |
IUPAC Name: | 5-chloro-1-methylimidazole |
Description: | A useful synthetic intermediate. |
Molecular Weight: | 116.55 |
Molecular Formula: | C4H5ClN2 |
Canonical SMILES: | CN1C=NC=C1Cl |
InChI: | InChI=1S/C4H5ClN2/c1-7-3-6-2-4(7)5/h2-3H,1H3 |
InChI Key: | NYDGOZPYEABERA-UHFFFAOYSA-N |
Boiling Point: | 82-85 ℃ (11 mmHg) |
Density: | 1.25 g/cm3 |
MDL: | MFCD00014505 |
LogP: | 1.07350 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-110975748-A | Method for preparing vesicle aggregates based on compounding of imidazole compounds and capric acid | 20191227 |
CN-112979655-A | Triazolopyridazine derivative, preparation method, pharmaceutical composition and application thereof | 20191216 |
WO-2021121294-A1 | Triazolopyridazine derivative, preparation method therefor, pharmaceutical composition thereof, and use thereof | 20191216 |
CN-112892426-A | Method for preparing vesicle aggregates based on compounding of imidazole compounds and capric acid | 20191203 |
CN-112599482-A | Semiconductor structure | 20190917 |
PMID | Publication Date | Title | Journal |
15360261 | 20040920 | Mechanistic elucidation of the substitution behavior of alkyl cobaloximes in water and methanol as solvents | Inorganic chemistry |
Complexity: | 66.7 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 116.0141259 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 116.0141259 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 17.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Imidazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS