5-Bromothiophene-2-carbonyl Chloride - CAS 31555-60-9
Catalog: |
BB020969 |
Product Name: |
5-Bromothiophene-2-carbonyl Chloride |
CAS: |
31555-60-9 |
Synonyms: |
5-bromo-2-thiophenecarbonyl chloride; 5-bromothiophene-2-carbonyl chloride |
IUPAC Name: | 5-bromothiophene-2-carbonyl chloride |
Description: | 5-Bromothiophene-2-carbonyl Chloride (CAS# 31555-60-9) is a useful research chemical. |
Molecular Weight: | 225.49 |
Molecular Formula: | C5H2BrClOS |
Canonical SMILES: | C1=C(SC(=C1)Br)C(=O)Cl |
InChI: | InChI=1S/C5H2BrClOS/c6-4-2-1-3(9-4)5(7)8/h1-2H |
InChI Key: | ORIONTBOMZNQIE-UHFFFAOYSA-N |
MDL: | MFCD03421417 |
LogP: | 2.88960 |
Publication Number | Title | Priority Date |
CN-112480094-A | Thiophene 2, 5-disubstituted-tetrahydroisoquinoline compounds, and preparation and application thereof | 20201209 |
US-2020190078-A1 | Neuroprotective aminothiazoles | 20181201 |
US-2019151303-A1 | Quinolines that modulate serca and their use for treating disease | 20170227 |
US-10772881-B2 | Quinolines that modulate SERCA and their use for treating disease | 20170227 |
US-2017281611-A1 | Quinolines and their use for treating endoplasmic reticulum stress-caused diseases | 20140829 |
Complexity: | 130 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 223.86983 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 223.86983 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 45.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS