5-Bromopyridine-3-acetonitrile - CAS 39891-08-2
Catalog: |
BB024181 |
Product Name: |
5-Bromopyridine-3-acetonitrile |
CAS: |
39891-08-2 |
Synonyms: |
2-(5-bromo-3-pyridinyl)acetonitrile; 2-(5-bromopyridin-3-yl)acetonitrile |
IUPAC Name: | 2-(5-bromopyridin-3-yl)acetonitrile |
Description: | 5-Bromopyridine-3-acetonitrile (CAS# 39891-08-2) is a useful research chemical. |
Molecular Weight: | 197.03 |
Molecular Formula: | C7H5BrN2 |
Canonical SMILES: | C1=C(C=NC=C1Br)CC#N |
InChI: | InChI=1S/C7H5BrN2/c8-7-3-6(1-2-9)4-10-5-7/h3-5H,1H2 |
InChI Key: | NGSJXAQHUJFHEF-UHFFFAOYSA-N |
Boiling Point: | 308.4 ℃ at 760 mmHg |
Density: | 1.575 g/cm3 |
MDL: | MFCD06657722 |
LogP: | 1.91018 |
GHS Hazard Statement: | H301 (100%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P311, P312, P321, P322, P330, P361, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021064189-A2 | Prostaglandin e2 (pge2) ep4 receptor antagonists | 20191002 |
WO-2020051564-A1 | Polycyclic compounds and methods for the targeted degradation of rapidly accelerated fibrosarcoma polypeptides | 20180907 |
AU-2019335516-A1 | Polycyclic compounds and methods for the targeted degradation of rapidly accelerated fibrosarcoma polypeptides | 20180907 |
CN-113164775-A | Polycyclic compounds and methods for rapid accelerated targeted degradation of fibrosarcoma polypeptides | 20180907 |
EP-3846907-A1 | Polycyclic compounds and methods for the targeted degradation of rapidly accelerated fibrosarcoma polypeptides | 20180907 |
Complexity: | 149 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 195.96361 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 195.96361 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 36.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS