5-Bromoindoxyl acetate - CAS 17357-14-1
Catalog: |
BB012933 |
Product Name: |
5-Bromoindoxyl acetate |
CAS: |
17357-14-1 |
Synonyms: |
(5-bromo-1H-indol-3-yl) acetate |
IUPAC Name: | (5-bromo-1H-indol-3-yl) acetate |
Description: | 5-Bromoindoxyl acetate (CAS# 17357-14-1) is a useful research chemical compound. |
Molecular Weight: | 254.08 |
Molecular Formula: | C10H8BrNO2 |
Canonical SMILES: | CC(=O)OC1=CNC2=C1C=C(C=C2)Br |
InChI: | InChI=1S/C10H8BrNO2/c1-6(13)14-10-5-12-9-3-2-7(11)4-8(9)10/h2-5,12H,1H3 |
InChI Key: | KFTGECHXNQBTNZ-UHFFFAOYSA-N |
Boiling Point: | 393.3 °C at 760 mmHg |
Density: | 1.632 g/cm3 |
MDL: | MFCD00037933 |
LogP: | 2.85570 |
Publication Number | Title | Priority Date |
CN-113040151-A | Application of alkaloid streptandole and derivatives thereof in preventing and treating plant virus and bacterial diseases | 20191226 |
US-2020060952-A1 | Photoprotective compositions containing malassezia-derived compounds and/or chemical analogs thereof | 20180824 |
US-2019337927-A1 | Photoprotective compositions containing malassezia-derived compounds and/or chemical analogs thereof | 20180507 |
US-2019345140-A1 | Photoprotective compositions containing malassezia-derived compounds and/or chemical analogs thereof | 20180412 |
WO-2019046551-A1 | THIOINDIRUBINES | 20170901 |
Complexity: | 234 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 252.97384 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 252.97384 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 42.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS