5-Bromobenzo[1,3]dioxole-4-carboxylic acid - CAS 72744-56-0
Catalog: |
BB034677 |
Product Name: |
5-Bromobenzo[1,3]dioxole-4-carboxylic acid |
CAS: |
72744-56-0 |
Synonyms: |
5-bromo-1,3-benzodioxole-4-carboxylic acid |
IUPAC Name: | 5-bromo-1,3-benzodioxole-4-carboxylic acid |
Description: | 5-Bromobenzo[1,3]dioxole-4-carboxylic acid (CAS# 72744-56-0) is a useful research chemical. |
Molecular Weight: | 245.03 |
Molecular Formula: | C8H5BrO4 |
Canonical SMILES: | C1OC2=C(O1)C(=C(C=C2)Br)C(=O)O |
InChI: | InChI=1S/C8H5BrO4/c9-4-1-2-5-7(13-3-12-5)6(4)8(10)11/h1-2H,3H2,(H,10,11) |
InChI Key: | HDNXEXSQANVCKC-UHFFFAOYSA-N |
Boiling Point: | 353.188 °C at 760 mmHg |
Melting Point: | 169-173 °C |
Purity: | 95 % |
Density: | 1.895 g/cm3 |
Appearance: | White to tan solid |
MDL: | MFCD00837590 |
LogP: | 1.87600 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021153665-A1 | Novel alkyne derivative | 20200130 |
EP-3157938-A1 | Hetero functional binding systems | 20140617 |
US-2017115285-A1 | Hetero functional binding systems | 20140617 |
WO-2015192183-A1 | Hetero functional binding systems | 20140617 |
US-10768176-B2 | Hetero functional binding systems | 20140617 |
Complexity: | 220 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 243.93712 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 243.93712 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 55.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS