5-Bromo-6-phenylpyridazin-3(2H)-one - CAS 90766-97-5
Catalog: |
BB039944 |
Product Name: |
5-Bromo-6-phenylpyridazin-3(2H)-one |
CAS: |
90766-97-5 |
Synonyms: |
4-bromo-3-phenyl-1H-pyridazin-6-one; 4-bromo-3-phenyl-1H-pyridazin-6-one |
IUPAC Name: | 4-bromo-3-phenyl-1H-pyridazin-6-one |
Description: | 5-Bromo-6-phenylpyridazin-3(2H)-one (CAS# 90766-97-5) is a useful research chemical. |
Molecular Weight: | 251.08 |
Molecular Formula: | C10H7BrN2O |
Canonical SMILES: | C1=CC=C(C=C1)C2=NNC(=O)C=C2Br |
InChI: | InChI=1S/C10H7BrN2O/c11-8-6-9(14)12-13-10(8)7-4-2-1-3-5-7/h1-6H,(H,12,14) |
InChI Key: | YMKYEOKAMFRYQC-UHFFFAOYSA-N |
Density: | 1.61 g/cm3 |
MDL: | MFCD02083298 |
LogP: | 2.19940 |
Publication Number | Title | Priority Date |
WO-2021057818-A1 | Fxia inhibitors and preparation method therefor and pharmaceutical use thereof | 20190927 |
CA-2960703-A1 | Pyridazinone derivatives as phosphoinositide 3-kinases inhibitors | 20140912 |
EP-3191491-A1 | Pyridazinone derivatives as phosphoinositide 3-kinases inhibitors | 20140912 |
EP-3191491-B1 | Pyridazinone derivatives as phosphoinositide 3-kinases inhibitors | 20140912 |
ES-2747648-T3 | Pyridazinone derivatives as phosphoinositide 3-kinase inhibitors | 20140912 |
Complexity: | 303 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 249.97418 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 249.97418 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 41.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS