5-bromo-6-chloronicotinic acid - CAS 29241-62-1
Catalog: |
BB020143 |
Product Name: |
5-bromo-6-chloronicotinic acid |
CAS: |
29241-62-1 |
Synonyms: |
5-bromo-6-chloro-3-pyridinecarboxylic acid; 5-bromo-6-chloropyridine-3-carboxylic acid |
IUPAC Name: | 5-bromo-6-chloropyridine-3-carboxylic acid |
Description: | 5-bromo-6-chloronicotinic acid (CAS# 29241-62-1) is a useful research chemical. |
Molecular Weight: | 236.45 |
Molecular Formula: | C6H3BrClNO2 |
Canonical SMILES: | C1=C(C=NC(=C1Br)Cl)C(=O)O |
InChI: | InChI=1S/C6H3BrClNO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11) |
InChI Key: | DXEUARPQHJXMII-UHFFFAOYSA-N |
Boiling Point: | 370 ℃ at 760 mmHg |
Melting Point: | 166-168 ℃ |
Purity: | 95 % |
Density: | 1.917 g/cm3 |
Appearance: | White solid |
MDL: | MFCD01927098 |
LogP: | 2.19570 |
GHS Hazard Statement: | H302 (88.64%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P302+P352, P305+P351+P338, P321, P330, P332+P313, P337+P313, P362, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021151014-A1 | Pgdh inhibitors and methods of making and using | 20200123 |
WO-2021143927-A1 | Compound acting as bcr-abl inhibitor | 20200119 |
US-2020297725-A1 | Allosteric bcr-abl proteolysis targeting chimeric compounds | 20190322 |
WO-2020192562-A1 | Substituted heterocyclic amide compound and preparation method therefor and pharmaceutical use thereof | 20190322 |
WO-2020198055-A1 | Allosteric bcr-abl proteolysis targeting chimeric compounds | 20190322 |
Complexity: | 167 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 234.90357 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 234.90357 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 50.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS