5-Bromo-4-methylbenzimidazole - CAS 952511-48-7
Catalog: |
BB041658 |
Product Name: |
5-Bromo-4-methylbenzimidazole |
CAS: |
952511-48-7 |
Synonyms: |
5-bromo-4-methyl-1H-benzimidazole; 5-bromo-4-methyl-1H-benzimidazole |
IUPAC Name: | 5-bromo-4-methyl-1H-benzimidazole |
Description: | 5-Bromo-4-methylbenzimidazole (CAS# 952511-48-7) is a useful research chemical. |
Molecular Weight: | 211.06 |
Molecular Formula: | C8H7BrN2 |
Canonical SMILES: | CC1=C(C=CC2=C1N=CN2)Br |
InChI: | InChI=1S/C8H7BrN2/c1-5-6(9)2-3-7-8(5)11-4-10-7/h2-4H,1H3,(H,10,11) |
InChI Key: | JNXOUOKRAGYUNE-UHFFFAOYSA-N |
MDL: | MFCD18642426 |
LogP: | 2.63380 |
Publication Number | Title | Priority Date |
AU-2018218965-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
AU-2018218965-B2 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
CA-3049643-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
EP-3580208-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
JP-2020506197-A | Novel heterocyclic compound, production method thereof and pharmaceutical composition containing the same | 20170207 |
Complexity: | 151 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 209.97926 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 209.97926 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 28.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS