5-Bromo-4-methoxy-6-methylpyrimidine - CAS 4319-87-3
Catalog: |
BB025361 |
Product Name: |
5-Bromo-4-methoxy-6-methylpyrimidine |
CAS: |
4319-87-3 |
Synonyms: |
5-bromo-4-methoxy-6-methylpyrimidine; 5-bromo-4-methoxy-6-methylpyrimidine |
IUPAC Name: | 5-bromo-4-methoxy-6-methylpyrimidine |
Description: | 5-Bromo-4-methoxy-6-methylpyrimidine (CAS# 4319-87-3) is a useful research chemical. |
Molecular Weight: | 203.04 |
Molecular Formula: | C6H7BrN2O |
Canonical SMILES: | CC1=C(C(=NC=N1)OC)Br |
InChI: | InChI=1S/C6H7BrN2O/c1-4-5(7)6(10-2)9-3-8-4/h3H,1-2H3 |
InChI Key: | YDPPNMNAHGZFDJ-UHFFFAOYSA-N |
LogP: | 1.55610 |
Publication Number | Title | Priority Date |
BR-112020013788-A2 | compound, pharmaceutical composition, use of a compound, and method of treatment. | 20180110 |
US-2020369672-A1 | 2,4,6,7-tetrahydro-pyrazolo[4,3-d]pyrimidin-5-one derivatives and related compounds as c5a receptor modulators for treating vasculitis and inflammatory diseases | 20180110 |
AU-2013343104-A1 | Heteroaromatic compounds and their use as dopamine D1 ligands | 20121108 |
CA-2890009-A1 | Heteroaromatic compounds and their use as dopamine d1 ligands | 20121108 |
CA-2890009-C | Heteroaromatic compounds and their use as dopamine d1 ligands | 20121108 |
Complexity: | 112 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 201.97418 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 201.97418 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 35 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Pyrimidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS