5-Bromo-3-fluoro-2-nitropyridine - CAS 1532517-95-5
Catalog: |
BB010869 |
Product Name: |
5-Bromo-3-fluoro-2-nitropyridine |
CAS: |
1532517-95-5 |
Synonyms: |
5-bromo-3-fluoro-2-nitropyridine; 5-bromo-3-fluoro-2-nitropyridine |
IUPAC Name: | 5-bromo-3-fluoro-2-nitropyridine |
Description: | 5-Bromo-3-fluoro-2-nitropyridine (CAS# 1532517-95-5) is a useful research chemical compound. |
Molecular Weight: | 220.98 |
Molecular Formula: | C5H2BrFN2O2 |
Canonical SMILES: | C1=C(C(=NC=C1Br)[N+](=O)[O-])F |
InChI: | InChI=1S/C5H2BrFN2O2/c6-3-1-4(7)5(8-2-3)9(10)11/h1-2H |
InChI Key: | YMXQSNGTVXQMLC-UHFFFAOYSA-N |
Appearance: | Solid |
LogP: | 2.41460 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021133917-A1 | Smarca inhibitors and uses thereof | 20191223 |
WO-2021123372-A1 | Novel compounds and their use | 20191219 |
WO-2021081207-A1 | Glp-1r modulating compounds | 20191025 |
US-2021171499-A1 | Glp-1r modulating compounds | 20191025 |
WO-2020251974-A1 | Smarca inhibitors and uses thereof | 20190610 |
Complexity: | 163 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 219.92837 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 219.92837 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 58.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS