5-Bromo-2-(methylthio)pyridine - CAS 51933-78-9
Catalog: |
BB027652 |
Product Name: |
5-Bromo-2-(methylthio)pyridine |
CAS: |
51933-78-9 |
Synonyms: |
5-bromo-2-methylsulfanylpyridine |
IUPAC Name: | 5-bromo-2-methylsulfanylpyridine |
Description: | 5-Bromo-2-(methylthio)pyridine (CAS# 51933-78-9) is a useful research chemical. |
Molecular Weight: | 204.09 |
Molecular Formula: | C6H6BrNS |
Canonical SMILES: | CSC1=NC=C(C=C1)Br |
InChI: | InChI=1S/C6H6BrNS/c1-9-6-3-2-5(7)4-8-6/h2-4H,1H3 |
InChI Key: | CFBYLVDSPYTKPR-UHFFFAOYSA-N |
Boiling Point: | 255.8 °C at 760 mmHg |
Purity: | 97 % |
Density: | 1.61 g/cm3 |
Appearance: | Solid |
MDL: | MFCD03411571 |
LogP: | 2.56600 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P305+P351+P338, P310, P330, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021130259-A1 | Dihydrocyclopenta-isoquinoline-sulfonamide derivatives compounds | 20191223 |
WO-2020261294-A1 | Novel apoptosis signal-regulating kinase 1 inhibitors | 20190626 |
WO-2020068607-A1 | Process for preparing the compound 2,2-difluoro-n-((1r,2s)-3-fluoro-1-hydroxy-1-(4-(6-(s-methylsulfonimidoyl)pyridin-3-yl)phenyl)propan-2-yl)acetamide | 20180924 |
EP-3856718-A1 | Process for preparing the compound 2,2-difluoro-n-((1r,2s)-3-fluoro-1-hydroxy-1-(4-(6-(s-methylsulfonimidoyl)pyridin-3-yl)phenyl)propan-2-yl)acetamide | 20180924 |
WO-2020038394-A1 | Pyrazolopyrimidine derivative and use thereof as pi3k inhibitor | 20180821 |
Complexity: | 89.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 202.94043 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 202.94043 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 38.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS