5-Bromo-2-methylisoindolin-1-one - CAS 868066-91-5
Catalog: |
BB038066 |
Product Name: |
5-Bromo-2-methylisoindolin-1-one |
CAS: |
868066-91-5 |
Synonyms: |
5-bromo-2-methyl-3H-isoindol-1-one; 5-bromo-2-methyl-3H-isoindol-1-one |
IUPAC Name: | 5-bromo-2-methyl-3H-isoindol-1-one |
Description: | 5-Bromo-2-methylisoindolin-1-one (CAS# 868066-91-5) is a useful research chemical. |
Molecular Weight: | 226.07 |
Molecular Formula: | C9H8BrNO |
Canonical SMILES: | CN1CC2=C(C1=O)C=CC(=C2)Br |
InChI: | InChI=1S/C9H8BrNO/c1-11-5-6-4-7(10)2-3-8(6)9(11)12/h2-4H,5H2,1H3 |
InChI Key: | WRFZBWHXIGUNLQ-UHFFFAOYSA-N |
Boiling Point: | 356.2 °C at 760 mmHg |
Density: | 1.589 g/cm3 |
LogP: | 1.97260 |
Publication Number | Title | Priority Date |
CN-111732548-A | N2-carbamyl aromatic ring-2-aminopyrimidine derivatives and medical application thereof | 20200611 |
WO-2021077010-A1 | Bifunctional molecules containing an e3 ubiquitine ligase binding moiety linked to a bcl6 targeting moiety | 20191017 |
WO-2021067606-A1 | Brm targeting compounds and associated methods of use | 20191001 |
WO-2021016333-A1 | Aryl sulfonamides as small molecule stat3 inhibitors | 20190722 |
WO-2020160151-A1 | 15-pgdh inhibitors | 20190131 |
Complexity: | 207 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 224.97893 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 224.97893 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 20.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS