5-Bromo-2-methylbenzyl Chloride - CAS 87604-18-0
Catalog: |
BB038546 |
Product Name: |
5-Bromo-2-methylbenzyl Chloride |
CAS: |
87604-18-0 |
Synonyms: |
4-bromo-2-(chloromethyl)-1-methylbenzene; 4-bromo-2-(chloromethyl)-1-methylbenzene |
IUPAC Name: | 4-bromo-2-(chloromethyl)-1-methylbenzene |
Description: | 5-Bromo-2-methylbenzyl Chloride (CAS# 87604-18-0) is a useful research chemical. |
Molecular Weight: | 219.51 |
Molecular Formula: | C8H8BrCl |
Canonical SMILES: | CC1=C(C=C(C=C1)Br)CCl |
InChI: | InChI=1S/C8H8BrCl/c1-6-2-3-8(9)4-7(6)5-10/h2-4H,5H2,1H3 |
InChI Key: | VGCLTQUMFLQQQU-UHFFFAOYSA-N |
LogP: | 3.49630 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P261, P264, P270, P271, P280, P301+P312, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P312, P321, P330, P363, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
TW-201932118-A | Pyranoglucosyl derivatives and uses thereof | 20180123 |
CA-3061609-A1 | Method for producing difluoromethylene compound | 20170428 |
CN-110536885-A | The manufacturing method of difluoro methylene compound | 20170428 |
EP-3617197-A1 | Method for producing difluoromethylene compound | 20170428 |
JP-WO2018199284-A1 | Method for producing difluoromethylene compound | 20170428 |
Complexity: | 105 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 217.94979 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 217.94979 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS