5-Bromo-2-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine - CAS 1111638-01-7
Catalog: |
BB002727 |
Product Name: |
5-Bromo-2-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine |
CAS: |
1111638-01-7 |
Synonyms: |
1-(benzenesulfonyl)-5-bromo-2-methylpyrrolo[2,3-b]pyridine |
IUPAC Name: | 1-(benzenesulfonyl)-5-bromo-2-methylpyrrolo[2,3-b]pyridine |
Description: | 5-Bromo-2-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine (CAS# 1111638-01-7) is a useful research chemical. |
Molecular Weight: | 351.22 |
Molecular Formula: | C14H11BrN2O2S |
Canonical SMILES: | CC1=CC2=CC(=CN=C2N1S(=O)(=O)C3=CC=CC=C3)Br |
InChI: | InChI=1S/C14H11BrN2O2S/c1-10-7-11-8-12(15)9-16-14(11)17(10)20(18,19)13-5-3-2-4-6-13/h2-9H,1H3 |
InChI Key: | RTBZYOAMRPSNGO-UHFFFAOYSA-N |
Purity: | 95 % |
MDL: | MFCD15529452 |
LogP: | 4.42500 |
Publication Number | Title | Priority Date |
WO-2020015744-A1 | Azaindole derivative and use thereof as fgfr and c-met inhibitor | 20180719 |
EP-3825314-A1 | Azaindole derivative and use thereof as fgfr and c-met inhibitor | 20180719 |
US-2021253571-A1 | Azaindole derivative and use thereof as fgfr and c-met inhibitor | 20180719 |
WO-2019120234-A2 | Compound functioning as bromodomain protein inhibitor, and composition | 20171220 |
EP-3719017-A2 | Compound functioning as bromodomain protein inhibitor, and composition | 20171220 |
Complexity: | 445 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 349.97246 |
Formal Charge: | 0 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 349.97246 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 60.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS