5-Bromo-2-(hydroxymethyl)thiazole - CAS 911052-85-2
Catalog: |
BB040048 |
Product Name: |
5-Bromo-2-(hydroxymethyl)thiazole |
CAS: |
911052-85-2 |
Synonyms: |
(5-bromo-2-thiazolyl)methanol; (5-bromo-1,3-thiazol-2-yl)methanol |
IUPAC Name: | (5-bromo-1,3-thiazol-2-yl)methanol |
Description: | 5-Bromo-2-(hydroxymethyl)thiazole (CAS# 911052-85-2) is a useful research chemical. |
Molecular Weight: | 194.05 |
Molecular Formula: | C4H4BrNOS |
Canonical SMILES: | C1=C(SC(=N1)CO)Br |
InChI: | InChI=1S/C4H4BrNOS/c5-3-1-6-4(2-7)8-3/h1,7H,2H2 |
InChI Key: | FZLWVPQHBVSVHP-UHFFFAOYSA-N |
LogP: | 1.39790 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
AU-2013230499-A1 | Phenicol antibacterials | 20120306 |
AU-2013230499-B2 | Phenicol antibacterials | 20120306 |
CA-2866354-A1 | Phenicol antibacterials | 20120306 |
CA-2866354-C | Phenicol antibacterials | 20120306 |
CA-2930081-A1 | Phenicol antibacterials | 20120306 |
Complexity: | 82.4 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 192.91970 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 192.91970 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 61.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS