5-Bromo-2-fluoro-m-xylene - CAS 99725-44-7
Catalog: |
BB042330 |
Product Name: |
5-Bromo-2-fluoro-m-xylene |
CAS: |
99725-44-7 |
Synonyms: |
5-bromo-2-fluoro-1,3-dimethylbenzene; 5-bromo-2-fluoro-1,3-dimethylbenzene |
IUPAC Name: | 5-bromo-2-fluoro-1,3-dimethylbenzene |
Description: | 5-Bromo-2-fluoro-m-xylene (CAS# 99725-44-7) is a useful research chemical. |
Molecular Weight: | 203.05 |
Molecular Formula: | C8H8BrF |
Canonical SMILES: | CC1=CC(=CC(=C1F)C)Br |
InChI: | InChI=1S/C8H8BrF/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
InChI Key: | ZXPHUVHMBKRRJF-UHFFFAOYSA-N |
Boiling Point: | 95 ℃ |
Density: | 1.45 g/cm3 |
MDL: | MFCD01320701 |
LogP: | 3.20500 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
KR-20210065883-A | Novel quinazoline redox derivatives and their use as bet inhibitors | 20191126 |
WO-2021107657-A1 | Novel quinazoline redox derivative, and use as bet inhibitor | 20191126 |
JP-2019099571-A | Pharmaceutical composition containing pyrazolopyridine derivative having GLP-1 receptor agonist activity | 20171129 |
WO-2018102419-A1 | Compounds containing a sulfonic group as kat inhibitors | 20161129 |
CA-3038479-A1 | Pyrazolopyridine derivative having glp-1 receptor agonist effect | 20160926 |
Complexity: | 104 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 201.97934 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 201.97934 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS