5-Bromo-2-fluoro-alpha-(trifluoromethyl)benzyl Alcohol - CAS 1039827-16-1
Catalog: |
BB001286 |
Product Name: |
5-Bromo-2-fluoro-alpha-(trifluoromethyl)benzyl Alcohol |
CAS: |
1039827-16-1 |
Synonyms: |
1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanol; 1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanol |
IUPAC Name: | 1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanol |
Description: | 5-Bromo-2-fluoro-alpha-(trifluoromethyl)benzyl Alcohol (CAS# 1039827-16-1) is a useful research chemical. |
Molecular Weight: | 273.02 |
Molecular Formula: | C8H5BrF4O |
Canonical SMILES: | C1=CC(=C(C=C1Br)C(C(F)(F)F)O)F |
InChI: | InChI=1S/C8H5BrF4O/c9-4-1-2-6(10)5(3-4)7(14)8(11,12)13/h1-3,7,14H |
InChI Key: | FRYOXCMTJUDLMZ-UHFFFAOYSA-N |
LogP: | 3.18390 |
Publication Number | Title | Priority Date |
WO-2016196337-A1 | Tetrasubstituted alkene compounds and their use | 20150529 |
AU-2008204910-A1 | 5-pyridinone substituted indazoles | 20070110 |
AU-2008204910-B2 | 5-pyridinone substituted indazoles | 20070110 |
CA-2673654-A1 | 5-pyridinone substituted indazoles | 20070110 |
EP-2121654-A1 | 5-pyridinone substituted indazoles | 20070110 |
Complexity: | 196 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 271.94599 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 271.94599 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 20.2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS